What is the molecular formula of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The molecular formula is C11H11NO2.
What is the molecular weight of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The molecular weight is 189.21 g/mol.
What is the IUPAC name of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The IUPAC name is 1-prop-2-enyl-3a,7a-dihydroindole-2,3-dione.
What is the InChI of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The InChI is InChI=1S/C11H11NO2/c1-2-7-12-9-6-4-3-5-8(9)10(13)11(12)14/h2-6,8-9H,1,7H2.
What is the InChIKey of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The InChIKey is IQCGMUPTHFNNDH-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The canonical SMILES is C=CCN1C2C=CC=CC2C(=O)C1=O.
What is the XLogP3-AA value of 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione?
The XLogP3-AA value is 1.2.
How many hydrogen bond donor counts does 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione have?
It has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione have?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does 1-Allyl-3a,7a-dihydro-1H-indole-2,3-dione have?
It has 2 rotatable bond counts.