CAS
--- Purity
---
--- Purity
---
Inquiry Basket
4-((Cyclopropylcarbonyl)amino)benzoic acid
Catalog Number
ACMA00000966
Category
Amines
Molecular Weight
205.21
Molecular Formula
C11H10N2S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of the compound?
The molecular formula of the compound is C11H11NO3.
What are the synonyms for the compound?
The synonyms for the compound are 4-[(cyclopropylcarbonyl)amino]benzoic acid, 23745-26-8, 4-(Cyclopropanecarboxamido)benzoic acid, and 4-cyclopropaneamidobenzoic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 205.21 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-(cyclopropanecarbonylamino)benzoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H11NO3/c13-10(7-1-2-7)12-9-5-3-8(4-6-9)11(14)15/h3-7H,1-2H2,(H,12,13)(H,14,15).
What is the InChIKey of the compound?
The InChIKey of the compound is RXFRECYQSDDFRO-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1CC1C(=O)NC2=CC=C(C=C2)C(=O)O.
What is the CAS number of the compound?
The CAS number of the compound is 23745-26-8.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 1.8.
Is the compound in its canonicalized form?
Yes, the compound is in its canonicalized form.
Recommended Products
