What is the molecular formula of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The molecular formula is C12H22N2O2.
What is the molecular weight of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The molecular weight is 226.32 g/mol.
What is the IUPAC name of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The IUPAC name is tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate.
What is the InChI of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The InChI is InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-6-4-12(5-7-14)8-13-9-12/h13H,4-9H2,1-3H3.
What is the InChIKey of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The InChIKey is NRADOPGBTAJXKB-UHFFFAOYSA-N.
What is the canonical SMILES of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The canonical SMILES is CC(C)(C)OC(=O)N1CCC2(CC1)CNC2.
What is the CAS number of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The CAS number is 896464-16-7.
What is the European Community (EC) number of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The EC number is 813-018-6.
What is the XLogP3-AA value of tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate?
The XLogP3-AA value is 1.1.
Is tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.