Spectinomycin

• CAS: 1695-77-8
• Catalog Number: ACM1695778
• Category: Other Products
• Molecular Weight: 332.35
• Molecular Formula: C₁₄H₂₄N₂O₇
• Synonyms: 4h-pyrano(2,3-b)(1,4)benzodioxin-4-one,decahydro-4a,7,9-trihydroxy-2-methyl-6,;8-bis(methylamino)-;actinospectacin;actinospectacina;antibiotic2233wp;espectinomicina;spectam;spectinomicina

Custom Q&A

What is the molecular formula of Spectinomycin?

The molecular formula of Spectinomycin is C14H24N2O7.

What is the molecular weight of Spectinomycin?

The molecular weight of Spectinomycin is 332.35 g/mol.

What is the IUPAC name of Spectinomycin?

The IUPAC name of Spectinomycin is (1R,3S,5R,8R,10R,11S,12S,13R,14S)-8,12,14-trihydroxy-5-methyl-11,13-bis(methylamino)-2,4,9-trioxatricyclo[8.4.0.0 3,8 ]tetradecan-7-one.

What is the InChI of Spectinomycin?

The InChI of Spectinomycin is InChI=1S/C14H24N2O7/c1-5-4-6(17)14(20)13(21-5)22-12-10(19)7(15-2)9(18)8(16-3)11(12)23-14/h5,7-13,15-16,18-20H,4H2,1-3H3/t5-,7-,8+,9+,10+,11-,12-,13+,14+/m1/s1.

How is Spectinomycin produced?

Spectinomycin is an antibiotic produced by the bacterium Streptomyces spectabilis.

What is the role of Spectinomycin?

Spectinomycin has a role as an antimicrobial agent, a bacterial metabolite, and an antibacterial drug.

What is a synonym for Spectinomycin?

Some synonyms for Spectinomycin include actinospectacin, Espectinomicina, and Trobicin.

What is the chemical structure of Spectinomycin?

The chemical structure of Spectinomycin is a pyranobenzodioxin.

What is the primary use of Spectinomycin?

Spectinomycin is primarily used to treat gonorrhea.

What is the common CID for Spectinomycin on PubChem?

The common CID for Spectinomycin on PubChem is 15541.