O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine

• CAS: 17041-36-0
• Catalog Number: ACM17041360
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₁₁H₂₀N₂O₈
• Synonyms: O-seryl-beta-N-acetylglucosaminide;2-Acetamido-2-deoxy-D-glucopyranosyl serine

Custom Q&A

What is the molecular formula of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The molecular formula is C11H20N2O8.

What is the molecular weight of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The molecular weight is 308.29 g/mol.

What is the InChI of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The InChI is InChI=1S/C11H20N2O8/c1-4(15)13-7-9(17)8(16)6(2-14)21-11(7)20-3-5(12)10(18)19/h5-9,11,14,16-17H,2-3,12H2,1H3,(H,13,15)(H,18,19)/t5-,6+,7+,8+,9+,11+/m0/s1

What is the Canonical SMILES of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The Canonical SMILES is CC(=O)NC1C(C(C(OC1OCC(C(=O)O)N)CO)O)O

How many Hydrogen Bond Donor Count does O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine have?

O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine has 6 hydrogen bond donor counts.

What is the Topological Polar Surface Area of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The Topological Polar Surface Area is 172 Ų.

How many Rotatable Bond Count does O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine have?

It has 6 rotatable bond counts.

What is the XLogP3-AA value of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The XLogP3-AA value is -5.6.

What is the Formal Charge of O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine?

The formal charge is 0.

How many Defined Atom Stereocenter Counts does O-(2-Acetamido-2-Deoxy-d-glucopyranosyl)-L-serine have?

It has 6 defined atom stereocenter counts.