Ricinelaidic acid

• Catalog Number: ACMA00000518
• Category: Alcohols
• Molecular Weight: 298.46
• Molecular Formula: C₁₅H₂₄O₄
• Hazard Statements: H319-H410
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of ricinelaidic acid?

The molecular formula of ricinelaidic acid is C18H34O3.

How is ricinelaidic acid described?

Ricinelaidic acid is described as a straight-chain, 18:1, long-chain fatty acid with a trans-double bond at position 9 and an R-oriented hydroxy group at position 12. It is functionally related to elaidic acid.

What is the synonyms of ricinelaidic acid?

The synonyms of ricinelaidic acid are ricinelaidic acid, 540-12-5, and ricinelaidicacid.

What is the molecular weight of ricinelaidic acid?

The molecular weight of ricinelaidic acid is 298.5 g/mol.

What is the IUPAC name of ricinelaidic acid?

The IUPAC name of ricinelaidic acid is (E,12R)-12-hydroxyoctadec-9-enoic acid.

What is the InChI of ricinelaidic acid?

The InChI of ricinelaidic acid is InChI=1S/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21)/b12-9+/t17-/m1/s1.

What is the InChIKey of ricinelaidic acid?

The InChIKey of ricinelaidic acid is WBHHMMIMDMUBKC-XLNAKTSKSA-N.

What are the other identifiers of ricinelaidic acid?

The other identifiers of ricinelaidic acid include CAS (540-12-5), UNII (9O64E391KI), ChEMBL ID (CHEMBL1235634), DSSTox Substance ID (DTXSID801316395), Metabolomics Workbench ID (2248), Nikkaji Number (J6.386J, J712.022B), Wikidata (Q7331160), and Wikipedia (Ricinelaidic_acid).

What is the XLogP3-AA value of ricinelaidic acid?

The XLogP3-AA value of ricinelaidic acid is 5.7.

What is the hydrogen bond donor count of ricinelaidic acid?

The hydrogen bond donor count of ricinelaidic acid is 2.