CAS
--- Purity
---
--- Purity
---
Inquiry Basket
Potassium ricinoleate
Catalog Number
ACMA00000519
Category
Alcohols
Molecular Weight
336.55
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H301
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of potassium ricinoleate?
The molecular formula of potassium ricinoleate is C18H33KO3.
What is the molecular weight of potassium ricinoleate?
The molecular weight of potassium ricinoleate is 336.6 g/mol.
What is the IUPAC name of potassium ricinoleate?
The IUPAC name of potassium ricinoleate is potassium;(Z,12R)-12-hydroxyoctadec-9-enoate.
What is the InChI of potassium ricinoleate?
The InChI of potassium ricinoleate is InChI=1S/C18H34O3.K/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);/q;+1/p-1/b12-9-;/t17-;/m1./s1.
What is the InChIKey of potassium ricinoleate?
The InChIKey of potassium ricinoleate is VAKMIIPDYZXBEV-DPMBMXLASA-M.
What is the canonical SMILES of potassium ricinoleate?
The canonical SMILES of potassium ricinoleate is CCCCCCC(CC=CCCCCCCCC(=O)[O-])O.[K+].
How many hydrogen bond donor count does potassium ricinoleate have?
Potassium ricinoleate has one hydrogen bond donor count.
How many hydrogen bond acceptor count does potassium ricinoleate have?
Potassium ricinoleate has three hydrogen bond acceptor count.
How many rotatable bond count does potassium ricinoleate have?
Potassium ricinoleate has fifteen rotatable bond count.
What is the exact mass and monoisotopic mass of potassium ricinoleate?
The exact mass and monoisotopic mass of potassium ricinoleate is 336.20667640 g/mol.
Recommended Products
