Trichloro(4-nonylphenyl)silane

• CAS: 139056-21-6
• Catalog Number: ACM139056216
• Category: Halosilane
• Molecular Weight: 337.79
• Molecular Formula: C₁₅H₂₃Cl₃Si
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of trichloro(4-nonylphenyl)silane?

The molecular formula of trichloro(4-nonylphenyl)silane is C15H23Cl3Si.

What is the molecular weight of trichloro(4-nonylphenyl)silane?

The molecular weight of trichloro(4-nonylphenyl)silane is 337.8 g/mol.

When was trichloro(4-nonylphenyl)silane created?

Trichloro(4-nonylphenyl)silane was created on December 1, 2012.

What is the IUPAC name of trichloro(4-nonylphenyl)silane?

The IUPAC name of trichloro(4-nonylphenyl)silane is trichloro-(4-nonylphenyl)silane.

What is the InChI of trichloro(4-nonylphenyl)silane?

The InChI of trichloro(4-nonylphenyl)silane is InChI=1S/C15H23Cl3Si/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)19(16,17)18/h10-13H,2-9H2,1H3.

What is the InChIKey of trichloro(4-nonylphenyl)silane?

The InChIKey of trichloro(4-nonylphenyl)silane is IFBMMSLHWHOERP-UHFFFAOYSA-N.

What is the canonical SMILES of trichloro(4-nonylphenyl)silane?

The canonical SMILES of trichloro(4-nonylphenyl)silane is CCCCCCCCCC1=CC=C(C=C1)[Si](Cl)(Cl)Cl.

What is the CAS number of trichloro(4-nonylphenyl)silane?

The CAS number of trichloro(4-nonylphenyl)silane is 139056-21-6.

What is the hydrogen bond donor count of trichloro(4-nonylphenyl)silane?

The hydrogen bond donor count of trichloro(4-nonylphenyl)silane is 0.

What is the hydrogen bond acceptor count of trichloro(4-nonylphenyl)silane?

The hydrogen bond acceptor count of trichloro(4-nonylphenyl)silane is 0.