27490-70-6 Purity
95%+
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is trichloro(2-phenylpropyl)silane.
The molecular formula of the compound is C9H11Cl3Si.
The molecular weight of the compound is 253.6 g/mol.
The InChI of the compound is InChI=1S/C9H11Cl3Si/c1-8(7-13(10,11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
The InChIKey of the compound is FROGNSXOSFZCJV-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C[Si](Cl)(Cl)Cl)C1=CC=CC=C1.
The compound has 0 hydrogen bond donor counts.
The compound has 0 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.
The topological polar surface area of the compound is 0Ų.