POTASSIUM (3-CHLOROPHENYL)TRIFLUOROBORATE

CAS

411206-75-2

Catalog Number

ACM411206752-1

Category

Borate

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of Potassium (3-chlorophenyl)trifluoroborate?

The molecular formula of Potassium (3-chlorophenyl)trifluoroborate is C6H4BClF3K.

What are the synonyms for Potassium (3-chlorophenyl)trifluoroborate?

The synonyms for Potassium (3-chlorophenyl)trifluoroborate are 411206-75-2, Potassium 3-chlorophenyltrifluoroborate, potassium;(3-chlorophenyl)-trifluoroboranuide, and MFCD04115754.

What is the molecular weight of Potassium (3-chlorophenyl)trifluoroborate?

The molecular weight of Potassium (3-chlorophenyl)trifluoroborate is 218.45 g/mol.

What is the parent compound of Potassium (3-chlorophenyl)trifluoroborate?

The parent compound of Potassium (3-chlorophenyl)trifluoroborate is CID 2782861 ((3-Chlorophenyl)-trifluoroboranuide).

What are the component compounds of Potassium (3-chlorophenyl)trifluoroborate?

The component compounds of Potassium (3-chlorophenyl)trifluoroborate are CID 2782861 ((3-Chlorophenyl)-trifluoroboranuide) and CID 5462222 (Potassium).

What is the IUPAC name of Potassium (3-chlorophenyl)trifluoroborate?

The IUPAC name of Potassium (3-chlorophenyl)trifluoroborate is potassium;(3-chlorophenyl)-trifluoroboranuide.

What is the InChI of Potassium (3-chlorophenyl)trifluoroborate?

The InChI of Potassium (3-chlorophenyl)trifluoroborate is InChI=1S/C6H4BClF3.K/c8-6-3-1-2-5(4-6)7(9,10)11;/h1-4H;/q-1;+1.

What is the InChIKey of Potassium (3-chlorophenyl)trifluoroborate?

The InChIKey of Potassium (3-chlorophenyl)trifluoroborate is LRJCVRYGKNDLAD-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium (3-chlorophenyl)trifluoroborate?

The canonical SMILES of Potassium (3-chlorophenyl)trifluoroborate is [B-](C1=CC(=CC=C1)Cl)(F)(F)F.[K+].

What is the CAS number of Potassium (3-chlorophenyl)trifluoroborate?

The CAS number of Potassium (3-chlorophenyl)trifluoroborate is 411206-75-2.

Recommended Products