Potassium (cyclopropoxymethyl)trifluoroborate

• CAS: 910251-14-8
• Catalog Number: ACM910251148
• Category: Borate

Custom Q&A

What is the molecular formula of Potassium (cyclopropoxymethyl)trifluoroborate?

The molecular formula of Potassium (cyclopropoxymethyl)trifluoroborate is C4H7BF3KO.

What are the synonyms of Potassium (cyclopropoxymethyl)trifluoroborate?

The synonyms of Potassium (cyclopropoxymethyl)trifluoroborate are potassium;cyclopropyloxymethyl(trifluoro)boranuide.

What is the molecular weight of Potassium (cyclopropoxymethyl)trifluoroborate?

The molecular weight of Potassium (cyclopropoxymethyl)trifluoroborate is 178.00 g/mol.

What is the IUPAC name of Potassium (cyclopropoxymethyl)trifluoroborate?

The IUPAC name of Potassium (cyclopropoxymethyl)trifluoroborate is potassium;cyclopropyloxymethyl(trifluoro)boranuide.

What is the InChI of Potassium (cyclopropoxymethyl)trifluoroborate?

The InChI of Potassium (cyclopropoxymethyl)trifluoroborate is InChI=1S/C4H7BF3O.K/c6-5(7,8)3-9-4-1-2-4;/h4H,1-3H2;/q-1;+1.

What is the InChIKey of Potassium (cyclopropoxymethyl)trifluoroborate?

The InChIKey of Potassium (cyclopropoxymethyl)trifluoroborate is SONNOKQLMPAMSG-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium (cyclopropoxymethyl)trifluoroborate?

The canonical SMILES of Potassium (cyclopropoxymethyl)trifluoroborate is [B-](COC1CC1)(F)(F)F.[K+].

What is the hydrogen bond donor count of Potassium (cyclopropoxymethyl)trifluoroborate?

The hydrogen bond donor count of Potassium (cyclopropoxymethyl)trifluoroborate is 0.

What is the hydrogen bond acceptor count of Potassium (cyclopropoxymethyl)trifluoroborate?

The hydrogen bond acceptor count of Potassium (cyclopropoxymethyl)trifluoroborate is 5.

What is the rotatable bond count of Potassium (cyclopropoxymethyl)trifluoroborate?

The rotatable bond count of Potassium (cyclopropoxymethyl)trifluoroborate is 2.