(p-Methylphenethyl)methyldimethoxysilane

• CAS: 722542-79-2
• Catalog Number: ACM722542792
• Category: Siloxanes
• Molecular Weight: 224.37
• Molecular Formula: C₁₂H₂₀O₂Si
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of (p-Methylphenethyl)methyldimethoxysilane?

The molecular formula is C12H20O2Si.

What is the molecular weight of (p-Methylphenethyl)methyldimethoxysilane?

The molecular weight is 224.37 g/mol.

What is the IUPAC name of (p-Methylphenethyl)methyldimethoxysilane?

The IUPAC name is dimethoxy-methyl-[2-(4-methylphenyl)ethyl]silane.

What is the InChI key of (p-Methylphenethyl)methyldimethoxysilane?

The InChI key is PYPWODPIJMONCS-UHFFFAOYSA-N.

What is the canonical SMILES representation of (p-Methylphenethyl)methyldimethoxysilane?

The canonical SMILES is CC1=CC=C(C=C1)CC[Si](C)(OC)OC.

What is the CAS number of (p-Methylphenethyl)methyldimethoxysilane?

The CAS number is 722542-79-2.

What is the EC number of (p-Methylphenethyl)methyldimethoxysilane?

The EC number is 804-055-9.

What is the DSSTox Substance ID of (p-Methylphenethyl)methyldimethoxysilane?

The DSSTox Substance ID is DTXSID40993008.

What is the hydrogen bond donor count of (p-Methylphenethyl)methyldimethoxysilane?

The hydrogen bond donor count is 0.

How many rotatable bonds does (p-Methylphenethyl)methyldimethoxysilane have?

It has 5 rotatable bonds.