What is the molecular formula of N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine?
The molecular formula is C12H18NO2P.
What is the IUPAC name of N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine?
The IUPAC name is N,N-diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine.
What is the molecular weight of N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine?
The molecular weight is 239.25 g/mol.
What is the Canonical SMILES representation of N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine?
The Canonical SMILES is CCN(CC)P1OCC2=CC=CC=C2CO1.
What is the InChIKey of N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine?
The InChIKey is JDAKPBBWYIWXJF-UHFFFAOYSA-N.
How many hydrogen bond acceptor count does N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine have?
It has 3 hydrogen bond acceptors.
What is the topological polar surface area of N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine?
The topological polar surface area is 21.7 Ų.
How many rotatable bond count does N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine have?
It has 3 rotatable bonds.
Is N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine a canonicalized compound?
Yes, it is a canonicalized compound.
When was N,N-Diethyl-1,5-dihydro-2,4,3-benzodioxaphosphepin-3-amine created and last modified in PubChem?
It was created on 2005-09-13 and last modified on 2023-12-30.