1,2-trans-Dimethylcyclopentane

• CAS: 822-50-4
• Catalog Number: ACM822504
• Category: Other Products
• Molecular Weight: 98.19
• Molecular Formula: C₇H₁₄
• Synonyms: 1,2-TRANS-DIMETHYLCYCLOPENTANE;TRANS-1,2-DIMETHYLCYCLOPENTANE;1,2-Dimethylcyclopentane, trans;1,trans-2-Dimethylcyclopentane;Cyclopentane, 1,2-dimethyl-;cyclopentane,1,trans-2-dimethyl-;t-1,2-Dimethylcyclopentane;Cyclopentane, 1,2-dimethyl-, trans-

Custom Q&A

What is the molecular formula of 1,2-trans-Dimethylcyclopentane?

The molecular formula is C7H14.

What is the molecular weight of 1,2-trans-Dimethylcyclopentane?

The molecular weight is 98.19 g/mol.

What are some synonyms for 1,2-trans-Dimethylcyclopentane?

Some synonyms include trans-1,2-Dimethylcyclopentane, and Cyclopentane, 1,2-dimethyl-, trans-.

What is the IUPAC Name of 1,2-trans-Dimethylcyclopentane?

The IUPAC Name is (1R,2R)-1,2-dimethylcyclopentane.

What is the InChI of 1,2-trans-Dimethylcyclopentane?

The InChI is InChI=1S/C7H14/c1-6-4-3-5-7(6)2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1.

What is the Canonical SMILES of 1,2-trans-Dimethylcyclopentane?

The Canonical SMILES is CC1CCCC1C.

How many hydrogen bond donor counts are there in 1,2-trans-Dimethylcyclopentane?

There are 0 hydrogen bond donor counts.

How many rotatable bond counts are there in 1,2-trans-Dimethylcyclopentane?

There are 0 rotatable bond counts.

What is the complexity of 1,2-trans-Dimethylcyclopentane?

The complexity is 49.1.