CAS
104819-48-9 Purity
96%
104819-48-9 Purity
96%
Inquiry Basket
Methyl 3-bromo-4-methylbenzoate
CAS
104901-43-1
Catalog Number
ACM104901431
Category
Bromine Series
Molecular Weight
229.07
Molecular Formula
C9H9BrO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 3-bromo-4-methylbenzoate.
What is the molecular formula of the compound?
The molecular formula of the compound is C9H9BrO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 229.07 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H9BrO2/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5H,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is MASRAGFWFYHMFI-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=C(C=C(C=C1)C(=O)OC)Br.
What is the CAS number of the compound?
The CAS number of the compound is 104901-43-1.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 600-619-1.
What is the Nikkaji Number of the compound?
The Nikkaji Number of the compound is J2.678.050K.
What is the formal charge of the compound?
The formal charge of the compound is 0.
Recommended Products
