3-Amino-2-bromo-4,6-dimethylpyridine

• CAS: 104829-98-3
• Catalog Number: ACM104829983
• Category: Bromine Series
• Molecular Weight: 201.06
• Molecular Formula: C₇H₉BrN₂

Custom Q&A

What is the molecular formula of 3-Amino-2-bromo-4,6-dimethylpyridine?

The molecular formula of 3-Amino-2-bromo-4,6-dimethylpyridine is C7H9BrN2.

What is the chemical structure of 3-Amino-2-bromo-4,6-dimethylpyridine?

The chemical structure of 3-Amino-2-bromo-4,6-dimethylpyridine is not provided in the reference.

What is the molecular weight of 3-Amino-2-bromo-4,6-dimethylpyridine?

The molecular weight of 3-Amino-2-bromo-4,6-dimethylpyridine is 201.06 g/mol.

What is the IUPAC name of 3-Amino-2-bromo-4,6-dimethylpyridine?

The IUPAC name of 3-Amino-2-bromo-4,6-dimethylpyridine is 2-bromo-4,6-dimethylpyridin-3-amine.

What is the InChI of 3-Amino-2-bromo-4,6-dimethylpyridine?

The InChI of 3-Amino-2-bromo-4,6-dimethylpyridine is InChI=1S/C7H9BrN2/c1-4-3-5(2)10-7(8)6(4)9/h3H,9H2,1-2H3.

What is the InChIKey of 3-Amino-2-bromo-4,6-dimethylpyridine?

The InChIKey of 3-Amino-2-bromo-4,6-dimethylpyridine is YHCPMPRWVKYCQS-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Amino-2-bromo-4,6-dimethylpyridine?

The canonical SMILES of 3-Amino-2-bromo-4,6-dimethylpyridine is CC1=CC(=NC(=C1N)Br)C.

What is the XLogP3-AA value of 3-Amino-2-bromo-4,6-dimethylpyridine?

The XLogP3-AA value of 3-Amino-2-bromo-4,6-dimethylpyridine is 2.

How many hydrogen bond donor counts does 3-Amino-2-bromo-4,6-dimethylpyridine have?

3-Amino-2-bromo-4,6-dimethylpyridine has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3-Amino-2-bromo-4,6-dimethylpyridine have?

3-Amino-2-bromo-4,6-dimethylpyridine has 2 hydrogen bond acceptor counts.