Methyl 3-bromo-4-fluorobenzoate

• CAS: 82702-31-6
• Catalog Number: ACM82702316
• Category: Bromine Series

Custom Q&A

What is the molecular formula of Methyl 3-bromo-4-fluorobenzoate?

The molecular formula is C8H6BrFO2.

What is the molecular weight of Methyl 3-bromo-4-fluorobenzoate?

The molecular weight is 233.03 g/mol.

What is the IUPAC name of Methyl 3-bromo-4-fluorobenzoate?

The IUPAC name is methyl 3-bromo-4-fluorobenzoate.

What is the InChI of Methyl 3-bromo-4-fluorobenzoate?

The InChI is InChI=1S/C8H6BrFO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,1H3.

What is the InChIKey of Methyl 3-bromo-4-fluorobenzoate?

The InChIKey is JVORYGNKYAXATM-UHFFFAOYSA-N.

What is the Canonical SMILES of Methyl 3-bromo-4-fluorobenzoate?

The Canonical SMILES is COC(=O)C1=CC(=C(C=C1)F)Br.

What is the CAS number of Methyl 3-bromo-4-fluorobenzoate?

The CAS number is 82702-31-6.

What is the European Community (EC) number of Methyl 3-bromo-4-fluorobenzoate?

The European Community (EC) number is 617-378-3.

What is the DSSTox Substance ID of Methyl 3-bromo-4-fluorobenzoate?

The DSSTox Substance ID is DTXSID30426936.

Is Methyl 3-bromo-4-fluorobenzoate a canonicalized compound?

Yes, Methyl 3-bromo-4-fluorobenzoate is a canonicalized compound.