4-(Bromomethyl)-5-phenyloxazole

• CAS: 368869-94-7
• Catalog Number: ACM368869947
• Category: Bromine Series
• Molecular Weight: 238.08
• Molecular Formula: C₁₀H₈BrNO
• Synonyms: 4-(BROMOMETHYL)-5-PHENYL-1,3-OXAZOLE;4-(Bromomethyl)-5-phenyl-1,3-oxazole 95%;4-(Bromomethyl)-5-phenyl-1,3-oxazole95%;4-(Bromomethyl)-5-phenyloxazole
• Density: 1.485g/cm³

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H8BrNO.

What is the molecular weight of the compound?

The molecular weight of the compound is 238.08 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-(bromomethyl)-5-phenyl-1,3-oxazole.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H8BrNO/c11-6-9-10(13-7-12-9)8-4-2-1-3-5-8/h1-5,7H,6H2.

What is the InChIKey of the compound?

The InChIKey of the compound is WHYSMAZUGYWNJN-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CC=C(C=C1)C2=C(N=CO2)CBr.

What is the CAS number of the compound?

The CAS number of the compound is 368869-94-7.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 810-860-6.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID40379969.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 26Ų.