Methyl 3-bromo-2-methyl-5-nitrobenzoate

• CAS: 885519-05-1
• Catalog Number: ACM885519051
• Category: Bromine Series

Custom Q&A

What is the molecular formula of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The molecular formula of methyl 3-bromo-2-methyl-5-nitrobenzoate is C9H8BrNO4.

What are the synonyms for methyl 3-bromo-2-methyl-5-nitrobenzoate?

The synonyms for methyl 3-bromo-2-methyl-5-nitrobenzoate are 885519-05-1, methyl3-bromo-2-methyl-5-nitrobenzoate, SCHEMBL1335440, and DTXSID10619889.

What is the molecular weight of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The molecular weight of methyl 3-bromo-2-methyl-5-nitrobenzoate is 274.07 g/mol.

What is the IUPAC name of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The IUPAC name of methyl 3-bromo-2-methyl-5-nitrobenzoate is methyl 3-bromo-2-methyl-5-nitrobenzoate.

What is the InChI of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The InChI of methyl 3-bromo-2-methyl-5-nitrobenzoate is InChI=1S/C9H8BrNO4/c1-5-7(9(12)15-2)3-6(11(13)14)4-8(5)10/h3-4H,1-2H3.

What is the InChIKey of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The InChIKey of methyl 3-bromo-2-methyl-5-nitrobenzoate is KHYSOGYKNCNXIS-UHFFFAOYSA-N.

What is the canonical SMILES of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The canonical SMILES of methyl 3-bromo-2-methyl-5-nitrobenzoate is CC1=C(C=C(C=C1Br)[N+](=O)[O-])C(=O)OC.

What is the XLogP3-AA value of methyl 3-bromo-2-methyl-5-nitrobenzoate?

The XLogP3-AA value of methyl 3-bromo-2-methyl-5-nitrobenzoate is 2.7.

How many hydrogen bond donor counts does methyl 3-bromo-2-methyl-5-nitrobenzoate have?

Methyl 3-bromo-2-methyl-5-nitrobenzoate has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does methyl 3-bromo-2-methyl-5-nitrobenzoate have?

Methyl 3-bromo-2-methyl-5-nitrobenzoate has 4 hydrogen bond acceptor counts.