3,5-Dibromobenzotrifluoride

• CAS: 401-84-3
• Catalog Number: ACM401843
• Category: Bromine Series
• Molecular Weight: 303.90
• Molecular Formula: C₇H₃Br₂F₃

Custom Q&A

What is the PubChem CID of 3,5-Dibromobenzotrifluoride?

The PubChem CID of 3,5-Dibromobenzotrifluoride is 2063489.

What is the molecular formula of 3,5-Dibromobenzotrifluoride?

The molecular formula of 3,5-Dibromobenzotrifluoride is C7H3Br2F3.

What are the synonyms of 3,5-Dibromobenzotrifluoride?

The synonyms of 3,5-Dibromobenzotrifluoride are 1,3-dibromo-5-(trifluoromethyl)benzene and MFCD00526219.

What is the molecular weight of 3,5-Dibromobenzotrifluoride?

The molecular weight of 3,5-Dibromobenzotrifluoride is 303.90 g/mol.

What is the IUPAC name of 3,5-Dibromobenzotrifluoride?

The IUPAC name of 3,5-Dibromobenzotrifluoride is 1,3-dibromo-5-(trifluoromethyl)benzene.

What is the InChI of 3,5-Dibromobenzotrifluoride?

The InChI of 3,5-Dibromobenzotrifluoride is InChI=1S/C7H3Br2F3/c8-5-1-4(7(10,11)12)2-6(9)3-5/h1-3H.

What is the InChIKey of 3,5-Dibromobenzotrifluoride?

The InChIKey of 3,5-Dibromobenzotrifluoride is OFNXSUANJLHGQN-UHFFFAOYSA-N.

What is the canonical SMILES of 3,5-Dibromobenzotrifluoride?

The canonical SMILES of 3,5-Dibromobenzotrifluoride is C1=C(C=C(C=C1Br)Br)C(F)(F)F.

What is the CAS number of 3,5-Dibromobenzotrifluoride?

The CAS number of 3,5-Dibromobenzotrifluoride is 401-84-3.