Ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate

• CAS: 179943-57-8
• Catalog Number: ACM179943578
• Category: Bromine Series
• Molecular Weight: 296.10
• Molecular Formula: C₁₂H₁₀BrNO₃

Custom Q&A

What is the molecular formula of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The molecular formula is C12H10BrNO3.

What is the molecular weight of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The molecular weight is 296.12 g/mol.

What is the IUPAC name of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The IUPAC name is ethyl 7-bromo-4-oxo-1H-quinoline-3-carboxylate.

What is the InChI of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The InChI is InChI=1S/C12H10BrNO3/c1-2-17-12(16)9-6-14-10-5-7(13)3-4-8(10)11(9)15/h3-6H,2H2,1H3,(H,14,15).

What is the InChIKey of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The InChIKey is WJFBKTAITAHHAR-UHFFFAOYSA-N.

What is the canonical SMILES of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The canonical SMILES is CCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2)Br.

What is the CAS number of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The CAS number is 179943-57-8.

What is the European Community (EC) number of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The European Community (EC) number is 801-098-5.

What is the XLogP3-AA value of ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate?

The XLogP3-AA value is 2.7.

Is ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate a canonicalized compound?

Yes, ethyl 7-bromo-4-hydroxyquinoline-3-carboxylate is canonicalized.