2,6-Dibromo-4-fluorochlorobenzene

• CAS: 179897-90-6
• Catalog Number: ACM179897906
• Category: Bromine Series
• Molecular Weight: 288.34
• Molecular Formula: C₆H₂Br₂ClF

Custom Q&A

What is the molecular formula of 2,6-Dibromo-4-fluorochlorobenzene?

The molecular formula of 2,6-Dibromo-4-fluorochlorobenzene is C6H2Br2ClF.

What is the molecular weight of 2,6-Dibromo-4-fluorochlorobenzene?

The molecular weight of 2,6-Dibromo-4-fluorochlorobenzene is 288.34 g/mol.

When was 2,6-Dibromo-4-fluorochlorobenzene created in PubChem?

2,6-Dibromo-4-fluorochlorobenzene was created in PubChem on July 19, 2005.

When was 2,6-Dibromo-4-fluorochlorobenzene last modified in PubChem?

The last modification of 2,6-Dibromo-4-fluorochlorobenzene in PubChem was on December 2, 2023.

What is the IUPAC name of 2,6-Dibromo-4-fluorochlorobenzene?

The IUPAC name of 2,6-Dibromo-4-fluorochlorobenzene is 1,3-dibromo-2-chloro-5-fluorobenzene.

What is the InChI of 2,6-Dibromo-4-fluorochlorobenzene?

The InChI of 2,6-Dibromo-4-fluorochlorobenzene is InChI=1S/C6H2Br2ClF/c7-4-1-3(10)2-5(8)6(4)9/h1-2H.

What is the InChIKey of 2,6-Dibromo-4-fluorochlorobenzene?

The InChIKey of 2,6-Dibromo-4-fluorochlorobenzene is PZKDJJMHRYNBOR-UHFFFAOYSA-N.

What is the canonical SMILES of 2,6-Dibromo-4-fluorochlorobenzene?

The canonical SMILES of 2,6-Dibromo-4-fluorochlorobenzene is C1=C(C=C(C(=C1Br)Cl)Br)F.

What is the CAS number of 2,6-Dibromo-4-fluorochlorobenzene?

The CAS number of 2,6-Dibromo-4-fluorochlorobenzene is 179897-90-6.

What is the molecular complexity of 2,6-Dibromo-4-fluorochlorobenzene?

The molecular complexity of 2,6-Dibromo-4-fluorochlorobenzene is 110.