381248-04-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of 4-Ethoxycarbonylphenylboronic acid is 2734350.
The molecular formula of 4-Ethoxycarbonylphenylboronic acid is C9H11BO4.
The molecular weight of 4-Ethoxycarbonylphenylboronic acid is 193.99 g/mol.
The IUPAC name of 4-Ethoxycarbonylphenylboronic acid is (4-ethoxycarbonylphenyl)boronic acid.
The InChI of 4-Ethoxycarbonylphenylboronic acid is InChI=1S/C9H11BO4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13/h3-6,12-13H,2H2,1H3.
The InChIKey of 4-Ethoxycarbonylphenylboronic acid is ZLNFACCFYUFTLD-UHFFFAOYSA-N.
The canonical SMILES of 4-Ethoxycarbonylphenylboronic acid is B(C1=CC=C(C=C1)C(=O)OCC)(O)O.
The CAS number of 4-Ethoxycarbonylphenylboronic acid is 4334-88-7.
The hydrogen bond donor count of 4-Ethoxycarbonylphenylboronic acid is 2.
Yes, 4-Ethoxycarbonylphenylboronic acid is a canonicalized compound.