5-Cyano-2-fluorophenylboronic acid

• CAS: 468718-30-1
• Catalog Number: ACM468718301
• Category: Boronic Acids
• Molecular Weight: 164.93
• Molecular Formula: C₇H₅BFNO₂
• Synonyms: AKOS BRN-0641;5-CYANO-2-FLUOROBENZENEBORONIC ACID;5-CYANO-2-FLUOROPHENYLBORONIC ACID;Boronic acid, (5-cyano-2-fluorophenyl)- (9CI);5-Cyano-2-fluorobenzeneboronic acid 98%;5-Cyano-2-fluorobenzeneboronicacid98%;3-Borono-4-fluorobenzonitrile

Custom Q&A

What is the molecular formula of 5-Cyano-2-fluorophenylboronic acid?

The molecular formula of 5-Cyano-2-fluorophenylboronic acid is C7H5BFNO2.

What is the molecular weight of 5-Cyano-2-fluorophenylboronic acid?

The molecular weight of 5-Cyano-2-fluorophenylboronic acid is 164.93 g/mol.

What is the IUPAC name of 5-Cyano-2-fluorophenylboronic acid?

The IUPAC name of 5-Cyano-2-fluorophenylboronic acid is (5-cyano-2-fluorophenyl)boronic acid.

What is the InChI key of 5-Cyano-2-fluorophenylboronic acid?

The InChI key of 5-Cyano-2-fluorophenylboronic acid is ITCSMTHUTFTXLE-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Cyano-2-fluorophenylboronic acid?

The canonical SMILES of 5-Cyano-2-fluorophenylboronic acid is B(C1=C(C=CC(=C1)C#N)F)(O)O.

What is the CAS number of 5-Cyano-2-fluorophenylboronic acid?

The CAS number of 5-Cyano-2-fluorophenylboronic acid is 468718-30-1.

What is the EC number of 5-Cyano-2-fluorophenylboronic acid?

The EC number of 5-Cyano-2-fluorophenylboronic acid is 640-591-8.

What is the hydrogen bond donor count of 5-Cyano-2-fluorophenylboronic acid?

The hydrogen bond donor count of 5-Cyano-2-fluorophenylboronic acid is 2.

What is the hydrogen bond acceptor count of 5-Cyano-2-fluorophenylboronic acid?

The hydrogen bond acceptor count of 5-Cyano-2-fluorophenylboronic acid is 4.

What is the topological polar surface area of 5-Cyano-2-fluorophenylboronic acid?

The topological polar surface area of 5-Cyano-2-fluorophenylboronic acid is 64.2Ų.