What is the molecular formula of 2-Dimethylaminoisopropyl chloride hydrochloride?
The molecular formula is C5H12ClN.ClH.
What are some synonyms for 2-Dimethylaminoisopropyl chloride hydrochloride?
Some synonyms include 2-chloro-N,N-dimethylpropan-1-amine hydrochloride and N,N-Dimethyl-2-chloropropylamine hydrochloride.
When was 2-Dimethylaminoisopropyl chloride hydrochloride created?
It was created on 2005-08-08.
What is the molecular weight of 2-Dimethylaminoisopropyl chloride hydrochloride?
The molecular weight is 158.07 g/mol.
What is the IUPAC Name of 2-Dimethylaminoisopropyl chloride hydrochloride?
The IUPAC Name is 2-chloro-N,N-dimethylpropan-1-amine;hydrochloride.
What is the InChI of 2-Dimethylaminoisopropyl chloride hydrochloride?
The InChI is InChI=1S/C5H12ClN.ClH/c1-5(6)4-7(2)3;/h5H,4H2,1-3H3;1H.
How many hydrogen bond donor counts does 2-Dimethylaminoisopropyl chloride hydrochloride have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Dimethylaminoisopropyl chloride hydrochloride?
The topological polar surface area is 3.2Ų.
How many defined atom stereocenter counts does 2-Dimethylaminoisopropyl chloride hydrochloride have?
It has 0 defined atom stereocenter count.
What is the UNII number of 2-Dimethylaminoisopropyl chloride hydrochloride?
The UNII number is AO9WB15SNZ.