6-Bromo-3-(4-bromo-2-methyl-phenyl)-isoquinolin-1-ylamine

• CAS: 954239-55-5
• Catalog Number: ACM954239555
• Category: Other Products
• Molecular Weight: 392.0922
• Molecular Formula: C16H12Br2N2
• Synonyms: 6-BROMO-3-(4-BROMO-2-METHYL-PHENYL)-ISOQUINOLIN-1-YLAMINE
• MDL Number: MFCD08752599
• Size: 50mg,100mg,250mg,500mg,1g,5g

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C16H12Br2N2.

What is the molecular weight of the compound?

The molecular weight of the compound is 392.09 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 6-bromo-3-(4-bromo-2-methylphenyl)isoquinolin-1-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C16H12Br2N2/c1-9-6-11(17)2-4-13(9)15-8-10-7-12(18)3-5-14(10)16(19)20-15/h2-8H,1H3,(H2,19,20).

What is the InChIKey of the compound?

The InChIKey of the compound is AUIGSHLHPQKZDC-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C=CC(=C1)Br)C2=NC(=C3C=CC(=CC3=C2)Br)N.

What is the CAS number of the compound?

The CAS number of the compound is 954239-55-5.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 5.2.

How many hydrogen bond donor atoms are there in the compound?

There is 1 hydrogen bond donor atom in the compound.

How many hydrogen bond acceptor atoms are there in the compound?

There are 2 hydrogen bond acceptor atoms in the compound.