1310383-06-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The chemical formula of 2-Aminophenylboronic acid is C6H8BNO2.
The molecular weight of 2-Aminophenylboronic acid is 136.95 g/mol.
The IUPAC name of 2-Aminophenylboronic acid is (2-aminophenyl)boronic acid.
The InChI of 2-Aminophenylboronic acid is InChI=1S/C6H8BNO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4,9-10H,8H2.
The InChIKey of 2-Aminophenylboronic acid is DIRRKLFMHQUJCM-UHFFFAOYSA-N.
The canonical SMILES of 2-Aminophenylboronic acid is B(C1=CC=CC=C1N)(O)O.
The CAS number of 2-Aminophenylboronic acid is 5570-18-3.
There are 3 hydrogen bond donor counts in 2-Aminophenylboronic acid.
There are 3 hydrogen bond acceptor counts in 2-Aminophenylboronic acid.