2-(Piperazin-1-yl)pyridine-5-boronicacid

• CAS: 1003043-67-1
• Catalog Number: ACM1003043671-1
• Category: Boro-Amino Acids

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is (6-piperazin-1-ylpyridin-3-yl)boronic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 207.04 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H14BN3O2/c14-10(15)8-1-2-9(12-7-8)13-5-3-11-4-6-13/h1-2,7,11,14-15H,3-6H2.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B(C1=CN=C(C=C1)N2CCNCC2)(O)O.

What is the CAS number of the compound?

The CAS number of the compound is 1003043-67-1.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 3.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 5.

What is the rotatable bond count of the compound?

The rotatable bond count of the compound is 2.

What is the exact mass of the compound?

The exact mass of the compound is 207.1179069 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.