6-(Di-Boc-Amino)pyridine-2-boronicacidpinacolester

CAS

1310384-87-2

Catalog Number

ACM1310384872

Category

Boronic Esters

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of the compound?

The molecular formula of the compound is C21H33BN2O6.

What are the synonyms for the compound?

The synonyms for the compound are 6-(Di-Boc-Amino)pyridine-2-boronic acid pinacol ester, 1310384-87-2, MFCD08752728, and AC1281.

What is the molecular weight of the compound?

The molecular weight of the compound is 420.3 g/mol.

When was the compound created?

The compound was created on June 21, 2010.

When was the compound last modified?

The compound was last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]carbamate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C21H33BN2O6/c1-18(2,3)27-16(25)24(17(26)28-19(4,5)6)15-13-11-12-14(23-15)22-29-20(7,8)21(9,10)30-22/h11-13H,1-10H3.

What is the InChIKey of the compound?

The InChIKey of the compound is VKNZXYHMNGMQRP-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 0.

Recommended Products