3-Amino-2-chloropyridine-6-boronic acid, pinacol ester

• CAS: 1150561-74-2
• Catalog Number: ACM1150561742-1
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H16BClN2O2.

What are the synonyms of the compound?

The synonyms of the compound are 1150561-74-2 and 2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine.

What is the molecular weight of the compound?

The molecular weight of the compound is 254.52 g/mol.

When was the compound created and last modified?

The compound was created on July 26, 2010, and last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H16BClN2O2/c1-10(2)11(3,4)17-12(16-10)8-6-5-7(14)9(13)15-8/h5-6H,14H2,1-4H3.

What is the InChIKey of the compound?

The InChIKey of the compound is RFWDIEIRRPLYLP-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=C(C=C2)N)Cl.

What is the CAS number of the compound?

The CAS number of the compound is 1150561-74-2.

Is the compound canonicalized?

Yes, the compound is canonicalized.