CAS
1014717-10-2 Purity
---
1014717-10-2 Purity
---
Inquiry Basket
5-Fluoro-2-methoxypyridin-4-ylboronic acid
CAS
1043869-98-2
Catalog Number
ACM1043869982-1
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID for 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The PubChem CID for 5-Fluoro-2-methoxypyridin-4-ylboronic acid is 44754837.
What is the molecular formula of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The molecular formula of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is C6H7BFNO3.
What are the synonyms of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The synonyms of 5-Fluoro-2-methoxypyridin-4-ylboronic acid include 5-Fluoro-2-methoxypyridine-4-boronic acid and (5-fluoro-2-methoxypyridin-4-yl)boronic acid.
What is the molecular weight of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The molecular weight of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is 170.94 g/mol.
What is the IUPAC name of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The IUPAC name of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is (5-fluoro-2-methoxypyridin-4-yl)boronic acid.
What is the InChI of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The InChI of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is InChI=1S/C6H7BFNO3/c1-12-6-2-4(7(10)11)5(8)3-9-6/h2-3,10-11H,1H3.
What is the InChIKey of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The InChIKey of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is VGPMZARHJYGFSE-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The Canonical SMILES of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is B(C1=CC(=NC=C1F)OC)(O)O.
What is the CAS number of 5-Fluoro-2-methoxypyridin-4-ylboronic acid?
The CAS number of 5-Fluoro-2-methoxypyridin-4-ylboronic acid is 1043869-98-2.
Recommended Products
![Lithium 4-methyl-1-(pyridin-2-yl)-2,6,7-trioxa-1-borabicyclo[2.2.2]octan-1-uide](https://resource.alfa-chemistry.com/structure/1014717-10-2.gif)
