3,5-Difluoro-4-iodophenylboronic acid

• CAS: 1257793-03-5
• Catalog Number: ACM1257793035
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 3,5-Difluoro-4-iodophenylboronic acid?

The molecular formula of 3,5-Difluoro-4-iodophenylboronic acid is C6H4BF2IO2.

What is the PubChem CID of 3,5-Difluoro-4-iodophenylboronic acid?

The PubChem CID of 3,5-Difluoro-4-iodophenylboronic acid is 57497316.

What is the IUPAC name of 3,5-Difluoro-4-iodophenylboronic acid?

The IUPAC name of 3,5-Difluoro-4-iodophenylboronic acid is (3,5-difluoro-4-iodophenyl)boronic acid.

What is the InChI of 3,5-Difluoro-4-iodophenylboronic acid?

The InChI of 3,5-Difluoro-4-iodophenylboronic acid is InChI=1S/C6H4BF2IO2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,11-12H.

What is the InChIKey of 3,5-Difluoro-4-iodophenylboronic acid?

The InChIKey of 3,5-Difluoro-4-iodophenylboronic acid is LSFYAVLDQLEKJH-UHFFFAOYSA-N.

What is the canonical SMILES of 3,5-Difluoro-4-iodophenylboronic acid?

The canonical SMILES of 3,5-Difluoro-4-iodophenylboronic acid is B(C1=CC(=C(C(=C1)F)I)F)(O)O.

What is the molecular weight of 3,5-Difluoro-4-iodophenylboronic acid?

The molecular weight of 3,5-Difluoro-4-iodophenylboronic acid is 283.81 g/mol.

How many hydrogen bond donor counts does 3,5-Difluoro-4-iodophenylboronic acid have?

3,5-Difluoro-4-iodophenylboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3,5-Difluoro-4-iodophenylboronic acid have?

3,5-Difluoro-4-iodophenylboronic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 3,5-Difluoro-4-iodophenylboronic acid have?

3,5-Difluoro-4-iodophenylboronic acid has 1 rotatable bond count.