5-Bromo-2-hydroxynicotinonitrile

• CAS: 405224-22-8
• Catalog Number: ACM405224228
• Category: Bromine Series
• Molecular Weight: 199.00
• Molecular Formula: C₆H₃N₂OBr

Custom Q&A

What is the molecular formula of 5-Bromo-2-hydroxynicotinonitrile?

The molecular formula is C6H3BrN2O.

What is the molecular weight of 5-Bromo-2-hydroxynicotinonitrile?

The molecular weight is 199.00 g/mol.

What is the IUPAC name of 5-Bromo-2-hydroxynicotinonitrile?

The IUPAC name is 5-bromo-2-oxo-1H-pyridine-3-carbonitrile.

What is the InChI of 5-Bromo-2-hydroxynicotinonitrile?

The InChI is InChI=1S/C6H3BrN2O/c7-5-1-4(2-8)6(10)9-3-5/h1,3H,(H,9,10).

What is the InChIKey of 5-Bromo-2-hydroxynicotinonitrile?

The InChIKey is SWTLLSLCDHXNIU-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-2-hydroxynicotinonitrile?

The canonical SMILES is C1=C(C(=O)NC=C1Br)C#N.

What is the CAS number of 5-Bromo-2-hydroxynicotinonitrile?

The CAS number is 405224-22-8.

What is the EC number of 5-Bromo-2-hydroxynicotinonitrile?

The EC number is 800-559-8.

What is the DSSTox Substance ID of 5-Bromo-2-hydroxynicotinonitrile?

The DSSTox Substance ID is DTXSID10428392.

Is 5-Bromo-2-hydroxynicotinonitrile a canonicalized compound?

Yes, 5-Bromo-2-hydroxynicotinonitrile is canonicalized.