6-Bromo-1H-indazol-3-amine

• CAS: 404827-77-6
• Catalog Number: ACM404827776
• Category: Bromine Series
• Molecular Weight: 212.04
• Molecular Formula: C₇H₆BrN₃

Custom Q&A

What is the molecular formula of 6-Bromo-1H-indazol-3-amine?

The molecular formula is C7H6BrN3.

What is the molecular weight of 6-Bromo-1H-indazol-3-amine?

The molecular weight is 212.05 g/mol.

What is the IUPAC name of 6-Bromo-1H-indazol-3-amine?

The IUPAC name is 6-bromo-1H-indazol-3-amine.

What is the InChI of 6-Bromo-1H-indazol-3-amine?

The InChI is InChI=1S/C7H6BrN3/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H3,9,10,11).

What is the InChIKey of 6-Bromo-1H-indazol-3-amine?

The InChIKey is WLDHNAMVDBASAW-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-1H-indazol-3-amine?

The canonical SMILES is C1=CC2=C(C=C1Br)NN=C2N.

What is the CAS number of 6-Bromo-1H-indazol-3-amine?

The CAS number is 404827-77-6.

What is the European Community (EC) number of 6-Bromo-1H-indazol-3-amine?

The European Community (EC) number is 690-455-7.

What is the ChEMBL ID of 6-Bromo-1H-indazol-3-amine?

The ChEMBL ID is CHEMBL501406.

Is 6-Bromo-1H-indazol-3-amine a canonicalized compound?

Yes, it is a canonicalized compound.