5-Aminoisoxazole-4-carboxamide hydrogensulfate

• CAS: 1273577-24-4
• Catalog Number: ACM1273577244
• Category: Other Products

Custom Q&A

What is the molecular formula of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The molecular formula is C4H7N3O6S.

What are the synonyms of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The synonyms include 5-AMINOISOXAZOLE-4-CARBOXAMIDE HYDROGENSULFATE, 1273577-24-4, and 5-Aminoisoxazole-4-carboxamide sulfate.

What is the molecular weight of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The molecular weight is 225.18 g/mol.

When was 5-Aminoisoxazole-4-carboxamide hydrogensulfate created?

It was created on May 30, 2012.

What is the IUPAC name of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The IUPAC name is 5-amino-1,2-oxazole-4-carboxamide;sulfuric acid.

What is the InChI of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The InChI is InChI=1S/C4H5N3O2.H2O4S/c5-3(8)2-1-7-9-4(2)6;1-5(2,3)4/h1H,6H2,(H2,5,8);(H2,1,2,3,4).

What is the InChIKey of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The InChIKey is IZAWQSSFWTZPAZ-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The canonical SMILES is C1=NOC(=C1C(=O)N)N.OS(=O)(=O)O.

What is the CAS number of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The CAS number is 1273577-24-4.

What is the hydrogen bond donor count of 5-Aminoisoxazole-4-carboxamide hydrogensulfate?

The hydrogen bond donor count is 4.