3-Methyl-4-morpholinophenylboronic acid

• CAS: 1426245-63-7
• Catalog Number: ACM1426245637
• Category: Other Products

Custom Q&A

What is the molecular formula of 3-Methyl-4-morpholinophenylboronic acid?

The molecular formula is C11H16BNO3.

What is the molecular weight of 3-Methyl-4-morpholinophenylboronic acid?

The molecular weight is 221.06 g/mol.

What is the IUPAC name of 3-Methyl-4-morpholinophenylboronic acid?

The IUPAC name is (3-methyl-4-morpholin-4-ylphenyl)boronic acid.

What is the InChI of 3-Methyl-4-morpholinophenylboronic acid?

The InChI is InChI=1S/C11H16BNO3/c1-9-8-10(12(14)15)2-3-11(9)13-4-6-16-7-5-13/h2-3,8,14-15H,4-7H2,1H3.

What is the InChIKey of 3-Methyl-4-morpholinophenylboronic acid?

The InChIKey is SPIHCTVLDYDVCE-UHFFFAOYSA-N.

What is the CAS number of 3-Methyl-4-morpholinophenylboronic acid?

The CAS number is 1426245-63-7.

What is the EC number of 3-Methyl-4-morpholinophenylboronic acid according to the European Community?

The EC number is 812-012-0.

How many hydrogen bond donor counts does 3-Methyl-4-morpholinophenylboronic acid have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Methyl-4-morpholinophenylboronic acid have?

It has 4 hydrogen bond acceptor counts.

What is the topological polar surface area of 3-Methyl-4-morpholinophenylboronic acid?

The topological polar surface area is 52.9 ?2.