4-Phenoxyacetophenone

• CAS: 5031-78-7
• Catalog Number: ACM5031787
• Category: Polymer/Macromolecule
• Molecular Weight: 212.24
• Molecular Formula: C₁₄H₁₂O₂
• Synonyms: P-PHENOXYACETOPHENONE;1-(4-PHENOXYPHENYL)ETHANONE;1-(4-PHENOXYPHENYL)-1-ETHANONE;1-ETHANONE, 1-(4-PHENOXYPHENYL)-;4-PHENOXYACETOPHENONE;4-PHENOXYACETOPHENONE;4-ACETYLDIPHENYL ETHER;METHYL-(4-PHENOXYPHENYL)-KETON

Custom Q&A

What is the molecular formula of 4-Phenoxyacetophenone?

The molecular formula of 4-Phenoxyacetophenone is C14H12O2.

What is the molecular weight of 4-Phenoxyacetophenone?

The molecular weight of 4-Phenoxyacetophenone is 212.24 g/mol.

What is the IUPAC name of 4-Phenoxyacetophenone?

The IUPAC name of 4-Phenoxyacetophenone is 1-(4-phenoxyphenyl)ethanone.

What is the InChI of 4-Phenoxyacetophenone?

The InChI of 4-Phenoxyacetophenone is InChI=1S/C14H12O2/c1-11(15)12-7-9-14(10-8-12)16-13-5-3-2-4-6-13/h2-10H,1H3.

What is the InChIKey of 4-Phenoxyacetophenone?

The InChIKey of 4-Phenoxyacetophenone is DJNIFZYQFLFGDT-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Phenoxyacetophenone?

The canonical SMILES of 4-Phenoxyacetophenone is CC(=O)C1=CC=C(C=C1)OC2=CC=CC=C2.

What is the CAS number of 4-Phenoxyacetophenone?

The CAS number of 4-Phenoxyacetophenone is 5031-78-7.

What is the XLogP3 value of 4-Phenoxyacetophenone?

The XLogP3 value of 4-Phenoxyacetophenone is 3.4.

How many hydrogen bond donor counts does 4-Phenoxyacetophenone have?

4-Phenoxyacetophenone has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Phenoxyacetophenone have?

4-Phenoxyacetophenone has 2 hydrogen bond acceptor counts.