What is the molecular formula of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The molecular formula is C7H12NNaO4S.
What is the molecular weight of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The molecular weight is 229.23 g/mol.
What is the IUPAC name of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The IUPAC name is sodium;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate.
What is the InChI of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The InChI is InChI=1S/C7H13NO4S.Na/c1-4-6(9)8-7(2,3)5-13(10,11)12;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);/q;+1/p-1.
What is the InChIKey of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The InChIKey is FWFUWXVFYKCSQA-UHFFFAOYSA-.
What is the canonical SMILES of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The canonical SMILES is CC(C)(CS(=O)(=O)[O-])NC(=O)C=C.[Na+].
What is the CAS number of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The CAS number is 5165-97-9.
What is the European Community (EC) Number of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The European Community (EC) Number is 225-948-4.
What is the UNII of 2-Acrylamido-2-methyl-1-propanesulfonic acid sodium salt?
The UNII is 2T9Q6EKI0G.