4-Nitrophenyl phosphorodichloridate

• CAS: 777-52-6
• Catalog Number: ACM777526
• Category: Organic Phosphine Compounds
• Molecular Weight: 255.98
• Molecular Formula: C₆H₄Cl₂NO₄P

Custom Q&A

What is the molecular formula of 4-Nitrophenyl phosphorodichloridate?

The molecular formula of 4-Nitrophenyl phosphorodichloridate is C6H4Cl2NO4P.

What is the molecular weight of 4-Nitrophenyl phosphorodichloridate?

The molecular weight of 4-Nitrophenyl phosphorodichloridate is 255.98 g/mol.

What is the IUPAC name of 4-Nitrophenyl phosphorodichloridate?

The IUPAC name of 4-Nitrophenyl phosphorodichloridate is 1-dichlorophosphoryloxy-4-nitrobenzene.

What is the InChI key of 4-Nitrophenyl phosphorodichloridate?

The InChI key of 4-Nitrophenyl phosphorodichloridate is NCPBESHYZRJICR-UHFFFAOYSA-N.

What is the canonical SMILES representation of 4-Nitrophenyl phosphorodichloridate?

The canonical SMILES representation of 4-Nitrophenyl phosphorodichloridate is C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(Cl)Cl.

What is the XLogP3 value of 4-Nitrophenyl phosphorodichloridate?

The XLogP3 value of 4-Nitrophenyl phosphorodichloridate is 2.8.

How many hydrogen bond acceptor counts are there in 4-Nitrophenyl phosphorodichloridate?

There are 4 hydrogen bond acceptor counts in 4-Nitrophenyl phosphorodichloridate.

What is the topological polar surface area of 4-Nitrophenyl phosphorodichloridate?

The topological polar surface area of 4-Nitrophenyl phosphorodichloridate is 72.1Ų.

How many heavy atoms are there in 4-Nitrophenyl phosphorodichloridate?

There are 14 heavy atoms in 4-Nitrophenyl phosphorodichloridate.

Is 4-Nitrophenyl phosphorodichloridate a canonicalized compound?

Yes, 4-Nitrophenyl phosphorodichloridate is a canonicalized compound.