4-Methoxycarbonylcubanecarboxylic acid

• CAS: 24539-28-4
• Catalog Number: ACM24539284
• Category: Other Products; Boronic Acids
• Molecular Weight: 206.19
• Molecular Formula: C₁₁H₁₀O₄

Custom Reviews

May 23, 2023

---

A useful photoinitiator.
Under radiation conditions, 4-Methoxycarbonylcubanecarboxylic acid was used as a reaction initiator to decarboxylate iodine.

Custom Q&A

What is the PubChem CID for 4-Methoxycarbonylcubanecarboxylic acid?

The PubChem CID for 4-Methoxycarbonylcubanecarboxylic acid is 369179.

What is the molecular formula of 4-Methoxycarbonylcubanecarboxylic acid?

The molecular formula of 4-Methoxycarbonylcubanecarboxylic acid is C11H10O4.

What is the molecular weight of 4-Methoxycarbonylcubanecarboxylic acid?

The molecular weight of 4-Methoxycarbonylcubanecarboxylic acid is 206.19 g/mol.

What is the IUPAC name of 4-Methoxycarbonylcubanecarboxylic acid?

The IUPAC name of 4-Methoxycarbonylcubanecarboxylic acid is 4-methoxycarbonylcubane-1-carboxylic acid.

What is the InChI of 4-Methoxycarbonylcubanecarboxylic acid?

The InChI of 4-Methoxycarbonylcubanecarboxylic acid is InChI=1S/C11H10O4/c1-15-9(14)11-5-2-6(11)4-7(11)3(5)10(2,4)8(12)13/h2-7H,1H3,(H,12,13).

What is the InChIKey of 4-Methoxycarbonylcubanecarboxylic acid?

The InChIKey of 4-Methoxycarbonylcubanecarboxylic acid is ARRJEFLYRAVFJA-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Methoxycarbonylcubanecarboxylic acid?

The canonical SMILES of 4-Methoxycarbonylcubanecarboxylic acid is COC(=O)C12C3C4C1C5C2C3C45C(=O)O.

What is the CAS number of 4-Methoxycarbonylcubanecarboxylic acid?

The CAS number of 4-Methoxycarbonylcubanecarboxylic acid is 24539-28-4.

How many hydrogen bond donor counts does 4-Methoxycarbonylcubanecarboxylic acid have?

4-Methoxycarbonylcubanecarboxylic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Methoxycarbonylcubanecarboxylic acid have?

4-Methoxycarbonylcubanecarboxylic acid has 4 hydrogen bond acceptor counts.