CAS
867044-35-7 Purity
---
867044-35-7 Purity
---
Inquiry Basket
3,5-Difluoro-4-isopropoxyphenylboronic acid
CAS
1451390-93-4
Catalog Number
ACM1451390934
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The molecular formula of 3,5-Difluoro-4-isopropoxyphenylboronic acid is C9H11BF2O3.
What is the PubChem CID number for 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The PubChem CID number for 3,5-Difluoro-4-isopropoxyphenylboronic acid is 56776591.
What is the molecular weight of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The molecular weight of 3,5-Difluoro-4-isopropoxyphenylboronic acid is 215.99 g/mol.
What is the IUPAC name of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The IUPAC name of 3,5-Difluoro-4-isopropoxyphenylboronic acid is (3,5-difluoro-4-propan-2-yloxyphenyl)boronic acid.
What is the InChI of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The InChI of 3,5-Difluoro-4-isopropoxyphenylboronic acid is InChI=1S/C9H11BF2O3/c1-5(2)15-9-7(11)3-6(10(13)14)4-8(9)12/h3-5,13-14H,1-2H3.
What is the InChIKey of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The InChIKey of 3,5-Difluoro-4-isopropoxyphenylboronic acid is SHSBRMCUHPYPIR-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The canonical SMILES of 3,5-Difluoro-4-isopropoxyphenylboronic acid is B(C1=CC(=C(C(=C1)F)OC(C)C)F)(O)O.
How many hydrogen bond donor counts does 3,5-Difluoro-4-isopropoxyphenylboronic acid have?
3,5-Difluoro-4-isopropoxyphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3,5-Difluoro-4-isopropoxyphenylboronic acid have?
3,5-Difluoro-4-isopropoxyphenylboronic acid has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 3,5-Difluoro-4-isopropoxyphenylboronic acid?
The topological polar surface area of 3,5-Difluoro-4-isopropoxyphenylboronic acid is 49.7Ų.
Recommended Products
