CAS
1263142-42-2 Purity
---
1263142-42-2 Purity
---
Inquiry Basket
4-Cyanophenylboronic acid pinacol ester
CAS
475250-43-2
Catalog Number
ACM475250432
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Cyanophenylboronic acid pinacol ester?
The molecular formula is C13H16BNO2.
What is the molecular weight of 4-Cyanophenylboronic acid pinacol ester?
The molecular weight is 229.08 g/mol.
What is the IUPAC name of 4-Cyanophenylboronic acid pinacol ester?
The IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
What is the InChI of 4-Cyanophenylboronic acid pinacol ester?
The InChI is InChI=1S/C13H16BNO2/c1-12(2)13(3,4)17-14(16-12)11-7-5-10(9-15)6-8-11/h5-8H,1-4H3.
What is the InChIKey of 4-Cyanophenylboronic acid pinacol ester?
The InChIKey is HOPDTPGXBZCBNP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Cyanophenylboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#N.
What is the CAS number of 4-Cyanophenylboronic acid pinacol ester?
The CAS number is 171364-82-2.
What is the EC number of 4-Cyanophenylboronic acid pinacol ester?
The EC number is 626-346-8.
What is the DSSTox Substance ID of 4-Cyanophenylboronic acid pinacol ester?
The DSSTox Substance ID is DTXSID30370405.
Is 4-Cyanophenylboronic acid pinacol ester considered a canonicalized compound?
Yes, it is considered a canonicalized compound.
Recommended Products
