CAS
1259370-17-6 Purity
---
1259370-17-6 Purity
---
Inquiry Basket
3,4-Dichloropyridine-5-boronic acid pinacol ester
CAS
1451391-08-4
Catalog Number
ACM1451391084
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The molecular formula is C11H14BCl2NO2.
What is the molecular weight of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The molecular weight is 274.0 g/mol.
When was 3,4-Dichloropyridine-5-boronic acid pinacol ester created?
It was created on July 1, 2014.
What is the IUPAC name of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The IUPAC name is 3,4-dichloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The InChI is InChI=1S/C11H14BCl2NO2/c1-10(2)11(3,4)17-12(16-10)7-5-15-6-8(13)9(7)14/h5-6H,1-4H3.
What is the InChIKey of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The InChIKey is YPRJPTVHFRCJEL-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=C2Cl)Cl.
How many hydrogen bond donor counts does 3,4-Dichloropyridine-5-boronic acid pinacol ester have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3,4-Dichloropyridine-5-boronic acid pinacol ester have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 3,4-Dichloropyridine-5-boronic acid pinacol ester?
The topological polar surface area is 31.4Ų.
Recommended Products
CAS
1263142-42-2 Purity
---
1263142-42-2 Purity
---
