What is the molecular formula of 4-Bromobenzene-1,3-diamine dihydrochloride?
The molecular formula is C6H9BrCl2N2.
What is the molecular weight of 4-Bromobenzene-1,3-diamine dihydrochloride?
The molecular weight is 259.96 g/mol.
What is the IUPAC name of 4-Bromobenzene-1,3-diamine dihydrochloride?
The IUPAC name is 4-bromobenzene-1,3-diamine;dihydrochloride.
What is the InChI of 4-Bromobenzene-1,3-diamine dihydrochloride?
The InChI is InChI=1S/C6H7BrN2.2ClH/c7-5-2-1-4(8)3-6(5)9;;/h1-3H,8-9H2;2*1H.
What is the InChIKey of 4-Bromobenzene-1,3-diamine dihydrochloride?
The InChIKey is ZPKHWILDPAREBE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromobenzene-1,3-diamine dihydrochloride?
The canonical SMILES is C1=CC(=C(C=C1N)N)Br.Cl.Cl.
What is the CAS number of 4-Bromobenzene-1,3-diamine dihydrochloride?
The CAS number is 1049728-71-3.
What is the EPA DSSTox Substance ID of 4-Bromobenzene-1,3-diamine dihydrochloride?
The EPA DSSTox Substance ID is DTXSID40584879.
What is the hydrogen bond donor count of 4-Bromobenzene-1,3-diamine dihydrochloride?
The hydrogen bond donor count is 4.
Is 4-Bromobenzene-1,3-diamine dihydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.