CAS
135795-51-6 Purity
96%
135795-51-6 Purity
96%
Inquiry Basket
4-Bromo-3-(trifluoromethyl)benzoic acid
CAS
161622-14-6
Catalog Number
ACM161622146
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The molecular formula of 4-Bromo-3-(trifluoromethyl)benzoic acid is C8H4BrF3O2.
What is the molecular weight of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The molecular weight of 4-Bromo-3-(trifluoromethyl)benzoic acid is 269.01 g/mol.
What is the IUPAC name of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The IUPAC name of 4-Bromo-3-(trifluoromethyl)benzoic acid is 4-bromo-3-(trifluoromethyl)benzoic acid.
What is the InChI of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The InChI of 4-Bromo-3-(trifluoromethyl)benzoic acid is InChI=1S/C8H4BrF3O2/c9-6-2-1-4(7(13)14)3-5(6)8(10,11)12/h1-3H,(H,13,14).
What is the InChIKey of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The InChIKey of 4-Bromo-3-(trifluoromethyl)benzoic acid is GPBPFDPENZHCPR-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The canonical SMILES of 4-Bromo-3-(trifluoromethyl)benzoic acid is C1=CC(=C(C=C1C(=O)O)C(F)(F)F)Br.
What is the CAS number of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The CAS number of 4-Bromo-3-(trifluoromethyl)benzoic acid is 161622-14-6.
What is the EC number of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The EC number of 4-Bromo-3-(trifluoromethyl)benzoic acid is 630-304-4.
What is the XLogP3-AA value of 4-Bromo-3-(trifluoromethyl)benzoic acid?
The XLogP3-AA value of 4-Bromo-3-(trifluoromethyl)benzoic acid is 3.
Is 4-Bromo-3-(trifluoromethyl)benzoic acid a canonicalized compound?
Yes, 4-Bromo-3-(trifluoromethyl)benzoic acid is a canonicalized compound.
Recommended Products
![5-Bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine](https://resource.alfa-chemistry.com/structure/757978-18-0.gif)
