CAS
135795-46-9 Purity
98%
135795-46-9 Purity
98%
Inquiry Basket
5-Bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine
CAS
757978-18-0
Catalog Number
ACM757978180
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C7H4BrIN2.
What is the molecular weight of the compound?
The molecular weight of the compound is 322.93 g/mol.
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is 5-bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H4BrIN2/c8-4-1-5-6(9)3-11-7(5)10-2-4/h1-3H,(H,10,11).
What is the InChIKey of the compound?
The InChIKey of the compound is GIPGJYARDOQGDJ-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=C(C=NC2=C1C(=CN2)I)Br.
What is the CAS number of the compound?
The CAS number of the compound is 757978-18-0.
What is the EC number of the compound?
The EC number of the compound is 626-727-9.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.7.
Is the compound a canonicalized compound?
Yes, the compound is canonicalized.
Recommended Products
