What is the molecular formula of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The molecular formula is C6H3Cl3N2OS.
What is the molecular weight of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The molecular weight is 257.5 g/mol.
What is the IUPAC name of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The IUPAC name is 4,6-dichloro-2-methylsulfanylpyrimidine-5-carbonyl chloride.
What is the InChI of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The InChI is InChI=1S/C6H3Cl3N2OS/c1-13-6-10-3(7)2(5(9)12)4(8)11-6/h1H3.
What is the InChIKey of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The InChIKey is MHZGWIOWCZZQNF-UHFFFAOYSA-N.
What is the canonical SMILES of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The canonical SMILES is CSC1=NC(=C(C(=N1)Cl)C(=O)Cl)Cl.
What is the CAS number of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The CAS number is 1269119-14-3.
What is the European Community (EC) number of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The European Community (EC) number is 694-337-6.
What is the XLogP3-AA value of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride?
The XLogP3-AA value is 3.5.
Is 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonyl chloride a canonicalized compound?
Yes, it is a canonicalized compound.