4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide

• CAS: 313339-36-5
• Catalog Number: ACM313339365
• Category: Pyrimidines
• Molecular Weight: 238.09
• Molecular Formula: C6H5Cl2N3OS
• Melting Point: 239-244 °C
• Appearance: Powder or Crystals

Custom Q&A

What is the molecular formula of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The molecular formula is C6H5Cl2N3OS.

What are the synonyms of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The synonyms include 4,6-dichloro-2-methylsulfanylpyrimidine-5-carboxamide and 4,6-DICHLORO-2-(METHYLSULFANYL)PYRIMIDINE-5-CARBOXAMIDE.

What is the molecular weight of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The molecular weight is 238.09 g/mol.

What is the IUPAC name of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The IUPAC name is 4,6-dichloro-2-methylsulfanylpyrimidine-5-carboxamide.

What is the InChI key of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The InChI key is QTFKDTZXKGLBBX-UHFFFAOYSA-N.

What is the canonical SMILES representation of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The canonical SMILES representation is CSC1=NC(=C(C(=N1)Cl)C(=O)N)Cl.

What is the CAS number of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The CAS number is 313339-36-5.

What is the European Community (EC) number of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The EC number is 694-506-4.

What is the XLogP3-AA value of 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide?

The XLogP3-AA value is 1.8.

Does 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxamide have any defined atom or bond stereocenter count?

No, it does not have any defined atom or bond stereocenter count.