What is the molecular formula of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The molecular formula is C8H8BFO4.
What is the molecular weight of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The molecular weight is 197.96 g/mol.
What is the IUPAC name of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The IUPAC name is (3-fluoro-5-methoxycarbonylphenyl)boronic acid.
What is the InChI of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The InChI is InChI=1S/C8H8BFO4/c1-14-8(11)5-2-6(9(12)13)4-7(10)3-5/h2-4,12-13H,1H3.
What is the InChIKey of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The InChIKey is VKHJVASTGLPBBL-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The canonical SMILES is B(C1=CC(=CC(=C1)F)C(=O)OC)(O)O.
What is the CAS number of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The CAS number is 871329-62-3.
What is the EC number of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The EC number is 801-967-9.
What is the DSSTox Substance ID of 3-Fluoro-5-methoxycarbonylphenylboronic acid?
The DSSTox Substance ID is DTXSID50660113.
Is 3-Fluoro-5-methoxycarbonylphenylboronic acid considered a canonical compound?
Yes, it is considered a canonical compound.