3-Fluoro-5-hydroxybenzeneboronic acid

• CAS: 871329-82-7
• Catalog Number: ACM871329827
• Category: Boronic Acids
• Molecular Weight: 155.92
• Molecular Formula: C₆H₆BFO₃

Custom Q&A

What is the PubChem CID of 3-Fluoro-5-hydroxybenzeneboronic acid?

The PubChem CID of 3-Fluoro-5-hydroxybenzeneboronic acid is 44717308.

What is the molecular formula of 3-Fluoro-5-hydroxybenzeneboronic acid?

The molecular formula of 3-Fluoro-5-hydroxybenzeneboronic acid is C6H6BFO3.

What is the molecular weight of 3-Fluoro-5-hydroxybenzeneboronic acid?

The molecular weight of 3-Fluoro-5-hydroxybenzeneboronic acid is 155.92 g/mol.

What is the IUPAC name of 3-Fluoro-5-hydroxybenzeneboronic acid?

The IUPAC name of 3-Fluoro-5-hydroxybenzeneboronic acid is (3-fluoro-5-hydroxyphenyl)boronic acid.

What is the InChI of 3-Fluoro-5-hydroxybenzeneboronic acid?

The InChI of 3-Fluoro-5-hydroxybenzeneboronic acid is InChI=1S/C6H6BFO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9-11H.

What is the CAS number of 3-Fluoro-5-hydroxybenzeneboronic acid?

The CAS number of 3-Fluoro-5-hydroxybenzeneboronic acid is 871329-82-7.

How many hydrogen bond donor counts does 3-Fluoro-5-hydroxybenzeneboronic acid have?

3-Fluoro-5-hydroxybenzeneboronic acid has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Fluoro-5-hydroxybenzeneboronic acid have?

3-Fluoro-5-hydroxybenzeneboronic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-Fluoro-5-hydroxybenzeneboronic acid have?

3-Fluoro-5-hydroxybenzeneboronic acid has 1 rotatable bond count.

Is 3-Fluoro-5-hydroxybenzeneboronic acid considered as a canonicalized compound?

Yes, 3-Fluoro-5-hydroxybenzeneboronic acid is considered as a canonicalized compound according to PubChem (release 2021.05.07).